Hi folks, I don't know if anyone is interested ot not, but I digged a book out and dipped into luminescence a bit longer.
It's not "hive" related, so sorry, just a bit of general chemistry knowledge (if anyone is interested)
The reaction
The reaction is a two step "one pot" one, and here's how it goes
1: Aryl Oxalate (e.g. bis(2,4,6-trichlorophenyl) oxalate) + Hydrogen peroxide + catalist -----> 1,2-dioxetane-3,4-dione + 2,4,6-trichlorophenol
2: 1,2-dioxetane-3,4-dione + Fluorophore Dye (http://www.semrock.com/Catalog/AllFluorophoresTable.htm)
(http://www.semrock.com/Catalog/AllFluorophoresTable.htm) -----> CO2 + Fluorophore + Light
Now with some pictures....
1:
Molecule: (https://www.the-hive.ws/forum/faq.pl?Cat=#applet)
bis(2,4,6-trichlorophenyl) oxalate ("ClC(C=C(Cl)C=C1Cl)=C1OC(C(OC2=C(Cl)C=C(Cl)C=C2Cl)=O)=O")
+
Molecule: (https://www.the-hive.ws/forum/faq.pl?Cat=#applet)
Hydrogen Peroxide ("[H]OO[H]")
----->
Molecule: (https://www.the-hive.ws/forum/faq.pl?Cat=#applet)
1,2-dioxetane-3,4-dione ("O=C1OOC1=O")
+
Molecule: (https://www.the-hive.ws/forum/faq.pl?Cat=#applet)
2,4,6-trichlorophenol ("ClC1=CC(Cl)=CC(Cl)=C1O ")
2:
Molecule: (https://www.the-hive.ws/forum/faq.pl?Cat=#applet)
1,2-dioxetane-3,4-dione ("O=C1OOC1=O ")
+ Fluorophore ----->
Molecule: (https://www.the-hive.ws/forum/faq.pl?Cat=#applet)
Carbon Dioxide (" O=C=O ")
+ Fluorophore + Light
And how it's done :
A solution of ~0.3% H2O2 + a catalytic amount of NaOH in THF was added dropwise to approximately 8 mL of the diaryl oxalate + fluorophore in THF (~25ºC) in a test tube (open vial)
The emission is relatively short lived but since H2O2 is apparently limiting, a second and third dropwise addition of the oxidant yields additional bursts of light.
Same Goes with Luminol :
Luminol (2,3-dihydrophthalazine-1,4-dione) + Hydrogen Peroxide + NaOH (-OH) + Catalist ----->
3-aminophthalate + Light
H2O2 +
Molecule: (https://www.the-hive.ws/forum/faq.pl?Cat=#applet)
Luminol (" O=C2NNC(C1=C(N)C=CC=C12)=O ")
AND (base -OH + catalyst) ----->
Molecule: (https://www.the-hive.ws/forum/faq.pl?Cat=#applet)
3-aminophthalate ("[O-]C(C1=C(N)C=CC=C1C([O-])=O)=O ")
+ Light