I would like to know more about the nature of calcium or barium or (iron?)-based coupling reactions. I know of two that are commonly employed here on the HIVE:
1. calcium (acetate,phenylacetate)--> P2P
2. calcium adipate --> cyclopentanone
I guess in both cases the other product is calcium carbonate.
Ca (OCOR1)(OCOR2) --> R1COCR2 + CaCO3
What is the limitation of this reaction?
What is its typical yield?
The idea I had was for yet another way of making ketamine. This one would work like so:
Molecule:
coupling reaction ("c1ccccc1C(=O)[O-].C2CCCC2C(=O)[O-].[Ca2+]>>c1ccccc1C(=O)C2CCCC2")
Both of the precursors are conceivably produceable from OTC materials (cyclohexanone --> cyclopentyl carboxylate, toluene --> benzoic acid), and no really nasty chemicals are involved. However, the reaction's success obviously depends on the effectiveness of the cross coupling reaction.
The two reactions involved are:
2A + 2B --> 2AB
2A + 2B --> AA + BB
How likely are each to occur, and what factors affect success?
Well, bees, what say you?